C26H26N4O6S2 — CID 18831629
4-[(5E)-5-[[2-(1,3-benzodioxol-5-ylmethylamino)-5-cyano-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 18831629) has the molecular formula C26H26N4O6S2 and a molecular weight of 554.65 g/mol. Its IUPAC name is 4-[(5E)-5-[[2-(1,3-benzodioxol-5-ylmethylamino)-5-cyano-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[(5E)-5-[[2-(1,3-benzodioxol-5-ylmethylamino)-5-cyano-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 18831629 |
| Molecular Formula | C26H26N4O6S2 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | 4-[(5E)-5-[[2-(1,3-benzodioxol-5-ylmethylamino)-5-cyano-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | CCCn1c(NCc2ccc3c(c2)OCO3)c(/C=C2/SC(=S)N(CCCC(=O)O)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C26H26N4O6S2/c1-3-8-29-23(28-13-16-6-7-19-20(10-16)36-14-35-19)17(15(2)18(12-27)24(29)33)11-21-25(34)30(26(37)38-21)9-4-5-22(31)32/h6-7,10-11,28H,3-5,8-9,13-14H2,1-2H3,(H,31,32)/b21-11+ |
| InChIKey | UKFVYIMSQZPVTL-SRZZPIQSSA-N |
| XLogP | 3.85 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|