C19H19FN2O3S2 — CID 18832218
N'-(4-fluorobenzoyl)-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carbohydrazide (PubChem CID 18832218) has the molecular formula C19H19FN2O3S2 and a molecular weight of 406.50 g/mol. Its IUPAC name is N'-(4-fluorobenzoyl)-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carbohydrazide.
| Compound Name | N'-(4-fluorobenzoyl)-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carbohydrazide |
|---|---|
| PubChem CID | 18832218 |
| Molecular Formula | C19H19FN2O3S2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | N'-(4-fluorobenzoyl)-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(F)cc2)oc2c1C1(CCC2)SCCS1 |
| InChI | InChI=1S/C19H19FN2O3S2/c1-11-15-14(3-2-8-19(15)26-9-10-27-19)25-16(11)18(24)22-21-17(23)12-4-6-13(20)7-5-12/h4-7H,2-3,8-10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | RBGJHYPIDCHURO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|