C18H17BrN2O4S2 — CID 18832178
N-(2-bromo-5-nitrophenyl)-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide (PubChem CID 18832178) has the molecular formula C18H17BrN2O4S2 and a molecular weight of 469.38 g/mol. Its IUPAC name is N-(2-bromo-5-nitrophenyl)-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide.
| Compound Name | N-(2-bromo-5-nitrophenyl)-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide |
|---|---|
| PubChem CID | 18832178 |
| Molecular Formula | C18H17BrN2O4S2 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | N-(2-bromo-5-nitrophenyl)-3'-methylspiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc([N+](=O)[O-])ccc2Br)oc2c1C1(CCC2)SCCS1 |
| InChI | InChI=1S/C18H17BrN2O4S2/c1-10-15-14(3-2-6-18(15)26-7-8-27-18)25-16(10)17(22)20-13-9-11(21(23)24)4-5-12(13)19/h4-5,9H,2-3,6-8H2,1H3,(H,20,22) |
| InChIKey | FRGAGAXBPRRRBH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|