C21H23Cl2NO2S — CID 18833823
2-(benzenesulfonyl)-4a-chloro-1-(2-chlorophenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline (PubChem CID 18833823) has the molecular formula C21H23Cl2NO2S and a molecular weight of 424.39 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-4a-chloro-1-(2-chlorophenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline.
| Compound Name | 2-(benzenesulfonyl)-4a-chloro-1-(2-chlorophenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
|---|---|
| PubChem CID | 18833823 |
| Molecular Formula | C21H23Cl2NO2S |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 2-(benzenesulfonyl)-4a-chloro-1-(2-chlorophenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
| SMILES | O=S(=O)(c1ccccc1)N1CCC2(Cl)CCCCC2C1c1ccccc1Cl |
| InChI | InChI=1S/C21H23Cl2NO2S/c22-19-12-5-4-10-17(19)20-18-11-6-7-13-21(18,23)14-15-24(20)27(25,26)16-8-2-1-3-9-16/h1-5,8-10,12,18,20H,6-7,11,13-15H2 |
| InChIKey | FQIRAEOYLCULFC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|