C26H19NO6S2 — CID 18841346
5-[(5Z)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid (PubChem CID 18841346) has the molecular formula C26H19NO6S2 and a molecular weight of 505.57 g/mol. Its IUPAC name is 5-[(5Z)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(5Z)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 18841346 |
| Molecular Formula | C26H19NO6S2 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 5-[(5Z)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(COc2ccccc2/C=C2\SC(=S)N(c3cc(C(=O)O)cc(C(=O)O)c3)C2=O)cc1 |
| InChI | InChI=1S/C26H19NO6S2/c1-15-6-8-16(9-7-15)14-33-21-5-3-2-4-17(21)13-22-23(28)27(26(34)35-22)20-11-18(24(29)30)10-19(12-20)25(31)32/h2-13H,14H2,1H3,(H,29,30)(H,31,32)/b22-13- |
| InChIKey | NUPJKDGGMFRCHV-XKZIYDEJSA-N |
| XLogP | 5.38 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|