C14H10ClN3O2S — CID 18843200
(5E)-2-[(2-chloro-3-pyridinyl)imino]-5-(furan-2-ylmethylidene)-3-methyl-1,3-thiazolidin-4-one (PubChem CID 18843200) has the molecular formula C14H10ClN3O2S and a molecular weight of 319.77 g/mol. Its IUPAC name is (5E)-2-[(2-chloro-3-pyridinyl)imino]-5-(furan-2-ylmethylidene)-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-[(2-chloro-3-pyridinyl)imino]-5-(furan-2-ylmethylidene)-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843200 |
| Molecular Formula | C14H10ClN3O2S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | (5E)-2-[(2-chloro-3-pyridinyl)imino]-5-(furan-2-ylmethylidene)-3-methyl-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2ccco2)S/C1=N/c1cccnc1Cl |
| InChI | InChI=1S/C14H10ClN3O2S/c1-18-13(19)11(8-9-4-3-7-20-9)21-14(18)17-10-5-2-6-16-12(10)15/h2-8H,1H3/b11-8+,17-14+ |
| InChIKey | FRRZSTTUPVGQRL-LDRANXPESA-N |
| XLogP | 3.56 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|