C26H18N4O4S — CID 18847862
[4-[(Z)-(5-oxo-3-pyridin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazol-6-ylidene)methyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 18847862) has the molecular formula C26H18N4O4S and a molecular weight of 482.52 g/mol. Its IUPAC name is [4-[(Z)-(5-oxo-3-pyridin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazol-6-ylidene)methyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(Z)-(5-oxo-3-pyridin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazol-6-ylidene)methyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18847862 |
| Molecular Formula | C26H18N4O4S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | [4-[(Z)-(5-oxo-3-pyridin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazol-6-ylidene)methyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2ccc(/C=c3\sc4nnc(-c5ccncc5)n4c3=O)cc2)cc1 |
| InChI | InChI=1S/C26H18N4O4S/c1-33-20-7-2-17(3-8-20)6-11-23(31)34-21-9-4-18(5-10-21)16-22-25(32)30-24(28-29-26(30)35-22)19-12-14-27-15-13-19/h2-16H,1H3/b11-6+,22-16- |
| InChIKey | CUEXBEMEHXHQMI-CTEVCFMWSA-N |
| XLogP | 3.39 |
| TPSA | 95.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|