C19H14N4O5S — CID 5106938
3-(3,4-dimethoxyphenyl)-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one (PubChem CID 5106938) has the molecular formula C19H14N4O5S and a molecular weight of 410.41 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one |
|---|---|
| PubChem CID | 5106938 |
| Molecular Formula | C19H14N4O5S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-6-[(4-nitrophenyl)methylidene]-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one |
| SMILES | COc1ccc(-c2nnc3sc(=Cc4ccc([N+](=O)[O-])cc4)c(=O)n23)cc1OC |
| InChI | InChI=1S/C19H14N4O5S/c1-27-14-8-5-12(10-15(14)28-2)17-20-21-19-22(17)18(24)16(29-19)9-11-3-6-13(7-4-11)23(25)26/h3-10H,1-2H3 |
| InChIKey | IXOLRBMQGVUNIL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|