C20H16N4O6S — CID 3574068
6-[(3-nitrophenyl)methylidene]-3-(3,4,5-trimethoxyphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one (PubChem CID 3574068) has the molecular formula C20H16N4O6S and a molecular weight of 440.44 g/mol. Its IUPAC name is 6-[(3-nitrophenyl)methylidene]-3-(3,4,5-trimethoxyphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one.
| Compound Name | 6-[(3-nitrophenyl)methylidene]-3-(3,4,5-trimethoxyphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one |
|---|---|
| PubChem CID | 3574068 |
| Molecular Formula | C20H16N4O6S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 6-[(3-nitrophenyl)methylidene]-3-(3,4,5-trimethoxyphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one |
| SMILES | COc1cc(-c2nnc3sc(=Cc4cccc([N+](=O)[O-])c4)c(=O)n23)cc(OC)c1OC |
| InChI | InChI=1S/C20H16N4O6S/c1-28-14-9-12(10-15(29-2)17(14)30-3)18-21-22-20-23(18)19(25)16(31-20)8-11-5-4-6-13(7-11)24(26)27/h4-10H,1-3H3 |
| InChIKey | RRZSTGSOKULVAV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 118.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|