C22H21N3O6S — CID 3851771
6-[(3,4-dimethoxyphenyl)methylidene]-3-(3,4,5-trimethoxyphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one (PubChem CID 3851771) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is 6-[(3,4-dimethoxyphenyl)methylidene]-3-(3,4,5-trimethoxyphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one.
| Compound Name | 6-[(3,4-dimethoxyphenyl)methylidene]-3-(3,4,5-trimethoxyphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one |
|---|---|
| PubChem CID | 3851771 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 6-[(3,4-dimethoxyphenyl)methylidene]-3-(3,4,5-trimethoxyphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one |
| SMILES | COc1ccc(C=c2sc3nnc(-c4cc(OC)c(OC)c(OC)c4)n3c2=O)cc1OC |
| InChI | InChI=1S/C22H21N3O6S/c1-27-14-7-6-12(8-15(14)28-2)9-18-21(26)25-20(23-24-22(25)32-18)13-10-16(29-3)19(31-5)17(11-13)30-4/h6-11H,1-5H3 |
| InChIKey | MDXZHIKGPJWHCL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |