C31H24N4O4S — CID 18867645
1'-[(3-methylphenyl)methyl]-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18867645) has the molecular formula C31H24N4O4S and a molecular weight of 548.62 g/mol. Its IUPAC name is 1'-[(3-methylphenyl)methyl]-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 1'-[(3-methylphenyl)methyl]-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18867645 |
| Molecular Formula | C31H24N4O4S |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 1'-[(3-methylphenyl)methyl]-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | Cc1cccc(CN2C(=O)C3(c4ccccc42)c2c(oc4ccccc4c2=O)C(=O)N3c2nnc(C(C)C)s2)c1 |
| InChI | InChI=1S/C31H24N4O4S/c1-17(2)27-32-33-30(40-27)35-28(37)26-24(25(36)20-11-4-7-14-23(20)39-26)31(35)21-12-5-6-13-22(21)34(29(31)38)16-19-10-8-9-18(3)15-19/h4-15,17H,16H2,1-3H3 |
| InChIKey | XQAXZYCQUHWXHY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |