C31H23FN4O4S — CID 18868628
7-fluoro-1'-[(3-methylphenyl)methyl]-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18868628) has the molecular formula C31H23FN4O4S and a molecular weight of 566.61 g/mol. Its IUPAC name is 7-fluoro-1'-[(3-methylphenyl)methyl]-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 7-fluoro-1'-[(3-methylphenyl)methyl]-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18868628 |
| Molecular Formula | C31H23FN4O4S |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 7-fluoro-1'-[(3-methylphenyl)methyl]-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | Cc1cccc(CN2C(=O)C3(c4ccccc42)c2c(oc4ccc(F)cc4c2=O)C(=O)N3c2nnc(C(C)C)s2)c1 |
| InChI | InChI=1S/C31H23FN4O4S/c1-16(2)27-33-34-30(41-27)36-28(38)26-24(25(37)20-14-19(32)11-12-23(20)40-26)31(36)21-9-4-5-10-22(21)35(29(31)39)15-18-8-6-7-17(3)13-18/h4-14,16H,15H2,1-3H3 |
| InChIKey | JKCKEKRDIAMGNS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |