C27H24N4O4S — CID 18868771
7-methyl-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)-1'-propylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18868771) has the molecular formula C27H24N4O4S and a molecular weight of 500.58 g/mol. Its IUPAC name is 7-methyl-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)-1'-propylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 7-methyl-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)-1'-propylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18868771 |
| Molecular Formula | C27H24N4O4S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 7-methyl-2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)-1'-propylspiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | CCCN1C(=O)C2(c3ccccc31)c1c(oc3ccc(C)cc3c1=O)C(=O)N2c1nnc(C(C)C)s1 |
| InChI | InChI=1S/C27H24N4O4S/c1-5-12-30-18-9-7-6-8-17(18)27(25(30)34)20-21(32)16-13-15(4)10-11-19(16)35-22(20)24(33)31(27)26-29-28-23(36-26)14(2)3/h6-11,13-14H,5,12H2,1-4H3 |
| InChIKey | CMWHUCHKGIEGJF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |