C25H19ClN4O4S — CID 18867738
7-chloro-1'-methyl-2-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18867738) has the molecular formula C25H19ClN4O4S and a molecular weight of 506.97 g/mol. Its IUPAC name is 7-chloro-1'-methyl-2-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 7-chloro-1'-methyl-2-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18867738 |
| Molecular Formula | C25H19ClN4O4S |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 7-chloro-1'-methyl-2-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | CC(C)Cc1nnc(N2C(=O)c3oc4ccc(Cl)cc4c(=O)c3C23C(=O)N(C)c2ccccc23)s1 |
| InChI | InChI=1S/C25H19ClN4O4S/c1-12(2)10-18-27-28-24(35-18)30-22(32)21-19(20(31)14-11-13(26)8-9-17(14)34-21)25(30)15-6-4-5-7-16(15)29(3)23(25)33/h4-9,11-12H,10H2,1-3H3 |
| InChIKey | DOGCCQJTDHTCDW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |