C32H19ClN4O4S2 — CID 18867760
7-chloro-1'-methyl-2-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione (PubChem CID 18867760) has the molecular formula C32H19ClN4O4S2 and a molecular weight of 623.12 g/mol. Its IUPAC name is 7-chloro-1'-methyl-2-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione.
| Compound Name | 7-chloro-1'-methyl-2-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
|---|---|
| PubChem CID | 18867760 |
| Molecular Formula | C32H19ClN4O4S2 |
| Molecular Weight | 623.12 g/mol |
| Exact Mass | 622.05 |
| IUPAC Name | 7-chloro-1'-methyl-2-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]spiro[chromeno[2,3-c]pyrrole-1,3'-indole]-2',3,9-trione |
| SMILES | CN1C(=O)C2(c3ccccc31)c1c(oc3ccc(Cl)cc3c1=O)C(=O)N2c1nnc(SCc2cccc3ccccc23)s1 |
| InChI | InChI=1S/C32H19ClN4O4S2/c1-36-23-12-5-4-11-22(23)32(29(36)40)25-26(38)21-15-19(33)13-14-24(21)41-27(25)28(39)37(32)30-34-35-31(43-30)42-16-18-9-6-8-17-7-2-3-10-20(17)18/h2-15H,16H2,1H3 |
| InChIKey | MHCZEWVKTZMWGZ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.12 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|