C28H33N5O5 — CID 18869301
N-[(5R)-5-(diethylamino)-6-[(2E)-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-6-oxohexyl]benzamide (PubChem CID 18869301) has the molecular formula C28H33N5O5 and a molecular weight of 519.60 g/mol. Its IUPAC name is N-[(5R)-5-(diethylamino)-6-[(2E)-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-6-oxohexyl]benzamide.
| Compound Name | N-[(5R)-5-(diethylamino)-6-[(2E)-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 18869301 |
| Molecular Formula | C28H33N5O5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | N-[(5R)-5-(diethylamino)-6-[(2E)-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-6-oxohexyl]benzamide |
| SMILES | CCN(CC)[C@H](CCCCNC(=O)c1ccccc1)C(=O)N/N=C/c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C28H33N5O5/c1-3-32(4-2)25(12-8-9-19-29-27(34)22-10-6-5-7-11-22)28(35)31-30-20-24-17-18-26(38-24)21-13-15-23(16-14-21)33(36)37/h5-7,10-11,13-18,20,25H,3-4,8-9,12,19H2,1-2H3,(H,29,34)(H,31,35)/b30-20+/t25-/m1/s1 |
| InChIKey | SPHHCVZVJSVNIC-WVDSIQFCSA-N |
| XLogP | 4.62 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|