C28H33BrN4O3 — CID 6134083
N-[6-[(2E)-2-[[5-(4-bromophenyl)furan-2-yl]methylidene]hydrazinyl]-5-(diethylamino)-6-oxohexyl]benzamide (PubChem CID 6134083) has the molecular formula C28H33BrN4O3 and a molecular weight of 553.50 g/mol. Its IUPAC name is N-[6-[(2E)-2-[[5-(4-bromophenyl)furan-2-yl]methylidene]hydrazinyl]-5-(diethylamino)-6-oxohexyl]benzamide.
| Compound Name | N-[6-[(2E)-2-[[5-(4-bromophenyl)furan-2-yl]methylidene]hydrazinyl]-5-(diethylamino)-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 6134083 |
| Molecular Formula | C28H33BrN4O3 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | N-[6-[(2E)-2-[[5-(4-bromophenyl)furan-2-yl]methylidene]hydrazinyl]-5-(diethylamino)-6-oxohexyl]benzamide |
| SMILES | CCN(CC)C(CCCCNC(=O)c1ccccc1)C(=O)N/N=C/c1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C28H33BrN4O3/c1-3-33(4-2)25(12-8-9-19-30-27(34)22-10-6-5-7-11-22)28(35)32-31-20-24-17-18-26(36-24)21-13-15-23(29)16-14-21/h5-7,10-11,13-18,20,25H,3-4,8-9,12,19H2,1-2H3,(H,30,34)(H,32,35)/b31-20+ |
| InChIKey | AOFFNIHASDOYGO-AJBULDERSA-N |
| XLogP | 5.47 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|