C26H36N4O3 — CID 4509165
N-[5-(diethylamino)-6-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-6-oxohexyl]benzamide (PubChem CID 4509165) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-[5-(diethylamino)-6-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-6-oxohexyl]benzamide.
| Compound Name | N-[5-(diethylamino)-6-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 4509165 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | N-[5-(diethylamino)-6-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-6-oxohexyl]benzamide |
| SMILES | CCOc1ccc(C=NNC(=O)C(CCCCNC(=O)c2ccccc2)N(CC)CC)cc1 |
| InChI | InChI=1S/C26H36N4O3/c1-4-30(5-2)24(14-10-11-19-27-25(31)22-12-8-7-9-13-22)26(32)29-28-20-21-15-17-23(18-16-21)33-6-3/h7-9,12-13,15-18,20,24H,4-6,10-11,14,19H2,1-3H3,(H,27,31)(H,29,32) |
| InChIKey | MUHJAPWJCCSSLY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|