C27H36N4O3 — CID 18869327
N-[(5R)-6-[(2E)-2-[(2-ethoxyphenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide (PubChem CID 18869327) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[(5R)-6-[(2E)-2-[(2-ethoxyphenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide.
| Compound Name | N-[(5R)-6-[(2E)-2-[(2-ethoxyphenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide |
|---|---|
| PubChem CID | 18869327 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | N-[(5R)-6-[(2E)-2-[(2-ethoxyphenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide |
| SMILES | CCOc1ccccc1/C=N/NC(=O)C(CCCCNC(=O)c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C27H36N4O3/c1-2-34-25-17-8-7-15-23(25)21-29-30-27(33)24(31-19-11-4-12-20-31)16-9-10-18-28-26(32)22-13-5-3-6-14-22/h3,5-8,13-15,17,21,24H,2,4,9-12,16,18-20H2,1H3,(H,28,32)(H,30,33)/b29-21+ |
| InChIKey | NMFRMNGCTDUYMT-XHLNEMQHSA-N |
| XLogP | 3.99 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|