C25H30Cl2N4O2 — CID 18869321
N-[(5S)-6-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide (PubChem CID 18869321) has the molecular formula C25H30Cl2N4O2 and a molecular weight of 489.45 g/mol. Its IUPAC name is N-[(5S)-6-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide.
| Compound Name | N-[(5S)-6-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide |
|---|---|
| PubChem CID | 18869321 |
| Molecular Formula | C25H30Cl2N4O2 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[(5S)-6-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide |
| SMILES | O=C(NCCCCC(C(=O)N/N=C/c1ccc(Cl)cc1Cl)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C25H30Cl2N4O2/c26-21-13-12-20(22(27)17-21)18-29-30-25(33)23(31-15-7-2-8-16-31)11-5-6-14-28-24(32)19-9-3-1-4-10-19/h1,3-4,9-10,12-13,17-18,23H,2,5-8,11,14-16H2,(H,28,32)(H,30,33)/b29-18+ |
| InChIKey | TVKWWVPGWGOMTM-RDRPBHBLSA-N |
| XLogP | 4.90 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|