C24H29BrN4O3 — CID 4508719
N-[6-[2-[(3-bromophenyl)methylidene]hydrazinyl]-5-morpholin-4-yl-6-oxohexyl]benzamide (PubChem CID 4508719) has the molecular formula C24H29BrN4O3 and a molecular weight of 501.43 g/mol. Its IUPAC name is N-[6-[2-[(3-bromophenyl)methylidene]hydrazinyl]-5-morpholin-4-yl-6-oxohexyl]benzamide.
| Compound Name | N-[6-[2-[(3-bromophenyl)methylidene]hydrazinyl]-5-morpholin-4-yl-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 4508719 |
| Molecular Formula | C24H29BrN4O3 |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | N-[6-[2-[(3-bromophenyl)methylidene]hydrazinyl]-5-morpholin-4-yl-6-oxohexyl]benzamide |
| SMILES | O=C(NCCCCC(C(=O)NN=Cc1cccc(Br)c1)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C24H29BrN4O3/c25-21-10-6-7-19(17-21)18-27-28-24(31)22(29-13-15-32-16-14-29)11-4-5-12-26-23(30)20-8-2-1-3-9-20/h1-3,6-10,17-18,22H,4-5,11-16H2,(H,26,30)(H,28,31) |
| InChIKey | QWWRLULNOSLXNP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|