C27H36N4O4 — CID 4509491
N-[6-[2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide (PubChem CID 4509491) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-[6-[2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide.
| Compound Name | N-[6-[2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide |
|---|---|
| PubChem CID | 4509491 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | N-[6-[2-[(3-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide |
| SMILES | CCOc1cc(C=NNC(=O)C(CCCCNC(=O)c2ccccc2)N2CCCCC2)ccc1O |
| InChI | InChI=1S/C27H36N4O4/c1-2-35-25-19-21(14-15-24(25)32)20-29-30-27(34)23(31-17-9-4-10-18-31)13-7-8-16-28-26(33)22-11-5-3-6-12-22/h3,5-6,11-12,14-15,19-20,23,32H,2,4,7-10,13,16-18H2,1H3,(H,28,33)(H,30,34) |
| InChIKey | NCZWQAZESRJJTF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|