C23H30N4O3 — CID 4509498
N-[6-[2-(furan-2-ylmethylidene)hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide (PubChem CID 4509498) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[6-[2-(furan-2-ylmethylidene)hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide.
| Compound Name | N-[6-[2-(furan-2-ylmethylidene)hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide |
|---|---|
| PubChem CID | 4509498 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-[6-[2-(furan-2-ylmethylidene)hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide |
| SMILES | O=C(NCCCCC(C(=O)NN=Cc1ccco1)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H30N4O3/c28-22(19-10-3-1-4-11-19)24-14-6-5-13-21(27-15-7-2-8-16-27)23(29)26-25-18-20-12-9-17-30-20/h1,3-4,9-12,17-18,21H,2,5-8,13-16H2,(H,24,28)(H,26,29) |
| InChIKey | PGHFGUGBTUURAH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|