C29H33N5O5 — CID 4509500
N-[6-[2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide (PubChem CID 4509500) has the molecular formula C29H33N5O5 and a molecular weight of 531.61 g/mol. Its IUPAC name is N-[6-[2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide.
| Compound Name | N-[6-[2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide |
|---|---|
| PubChem CID | 4509500 |
| Molecular Formula | C29H33N5O5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | N-[6-[2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-6-oxo-5-piperidin-1-ylhexyl]benzamide |
| SMILES | O=C(NCCCCC(C(=O)NN=Cc1ccc(-c2ccc([N+](=O)[O-])cc2)o1)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C29H33N5O5/c35-28(23-9-3-1-4-10-23)30-18-6-5-11-26(33-19-7-2-8-20-33)29(36)32-31-21-25-16-17-27(39-25)22-12-14-24(15-13-22)34(37)38/h1,3-4,9-10,12-17,21,26H,2,5-8,11,18-20H2,(H,30,35)(H,32,36) |
| InChIKey | DYJALXCYBSEKDC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|