C16H19N3O4 — CID 18870641
N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-1-(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine (PubChem CID 18870641) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-1-(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine.
| Compound Name | N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-1-(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 18870641 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-1-(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine |
| SMILES | COC1C=CC(CNCc2nnc(-c3ccccc3)o2)(OC)O1 |
| InChI | InChI=1S/C16H19N3O4/c1-20-14-8-9-16(21-2,23-14)11-17-10-13-18-19-15(22-13)12-6-4-3-5-7-12/h3-9,14,17H,10-11H2,1-2H3 |
| InChIKey | RRYSQPQQDSEURR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|