C26H21Cl2N3O3S — CID 18875335
(2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide (PubChem CID 18875335) has the molecular formula C26H21Cl2N3O3S and a molecular weight of 526.45 g/mol. Its IUPAC name is (2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | (2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 18875335 |
| Molecular Formula | C26H21Cl2N3O3S |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | (2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(furan-2-ylmethyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)C(Cc3cccc(Cl)c3Cl)S/C2=C(/C#N)C(=O)NCc2ccco2)cc1C |
| InChI | InChI=1S/C26H21Cl2N3O3S/c1-15-8-9-18(11-16(15)2)31-25(33)22(12-17-5-3-7-21(27)23(17)28)35-26(31)20(13-29)24(32)30-14-19-6-4-10-34-19/h3-11,22H,12,14H2,1-2H3,(H,30,32)/b26-20- |
| InChIKey | POHCKRAJAJKVCT-QOMWVZHYSA-N |
| XLogP | 5.95 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|