C24H16BrCl2N3O3S — CID 1177849
(2Z)-2-[(5S)-3-(4-bromophenyl)-5-[(2,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(furan-2-ylmethyl)acetamide (PubChem CID 1177849) has the molecular formula C24H16BrCl2N3O3S and a molecular weight of 577.29 g/mol. Its IUPAC name is (2Z)-2-[(5S)-3-(4-bromophenyl)-5-[(2,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(furan-2-ylmethyl)acetamide.
| Compound Name | (2Z)-2-[(5S)-3-(4-bromophenyl)-5-[(2,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 1177849 |
| Molecular Formula | C24H16BrCl2N3O3S |
| Molecular Weight | 577.29 g/mol |
| Exact Mass | 574.95 |
| IUPAC Name | (2Z)-2-[(5S)-3-(4-bromophenyl)-5-[(2,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(furan-2-ylmethyl)acetamide |
| SMILES | N#C/C(C(=O)NCc1ccco1)=C1/S[C@@H](Cc2cc(Cl)ccc2Cl)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H16BrCl2N3O3S/c25-15-3-6-17(7-4-15)30-23(32)21(11-14-10-16(26)5-8-20(14)27)34-24(30)19(12-28)22(31)29-13-18-2-1-9-33-18/h1-10,21H,11,13H2,(H,29,31)/b24-19-/t21-/m0/s1 |
| InChIKey | SOIORIDFEMAAPF-GHIWRQRASA-N |
| XLogP | 6.09 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.29 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|