C19H15NO4S — CID 18884383
3-(2-naphthalen-2-yloxyethyl)-1,1-dioxo-1,3-benzothiazol-2-one (PubChem CID 18884383) has the molecular formula C19H15NO4S and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-(2-naphthalen-2-yloxyethyl)-1,1-dioxo-1,3-benzothiazol-2-one.
| Compound Name | 3-(2-naphthalen-2-yloxyethyl)-1,1-dioxo-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 18884383 |
| Molecular Formula | C19H15NO4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 3-(2-naphthalen-2-yloxyethyl)-1,1-dioxo-1,3-benzothiazol-2-one |
| SMILES | O=C1N(CCOc2ccc3ccccc3c2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C19H15NO4S/c21-19-20(17-7-3-4-8-18(17)25(19,22)23)11-12-24-16-10-9-14-5-1-2-6-15(14)13-16/h1-10,13H,11-12H2 |
| InChIKey | LZMDFTFENIODKG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|