C16H14ClNO4S — CID 18884390
3-[3-(2-chlorophenoxy)propyl]-1,1-dioxo-1,3-benzothiazol-2-one (PubChem CID 18884390) has the molecular formula C16H14ClNO4S and a molecular weight of 351.81 g/mol. Its IUPAC name is 3-[3-(2-chlorophenoxy)propyl]-1,1-dioxo-1,3-benzothiazol-2-one.
| Compound Name | 3-[3-(2-chlorophenoxy)propyl]-1,1-dioxo-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 18884390 |
| Molecular Formula | C16H14ClNO4S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 3-[3-(2-chlorophenoxy)propyl]-1,1-dioxo-1,3-benzothiazol-2-one |
| SMILES | O=C1N(CCCOc2ccccc2Cl)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C16H14ClNO4S/c17-12-6-1-3-8-14(12)22-11-5-10-18-13-7-2-4-9-15(13)23(20,21)16(18)19/h1-4,6-9H,5,10-11H2 |
| InChIKey | XCZJIXFAXDEOBS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|