C26H22N2O3S — CID 18884657
2-(4-ethylphenyl)-4-(4-methoxyphenyl)-4,5-dihydropyrrolo[3,4-b][1,5]benzothiazepine-1,3-dione (PubChem CID 18884657) has the molecular formula C26H22N2O3S and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-4-(4-methoxyphenyl)-4,5-dihydropyrrolo[3,4-b][1,5]benzothiazepine-1,3-dione.
| Compound Name | 2-(4-ethylphenyl)-4-(4-methoxyphenyl)-4,5-dihydropyrrolo[3,4-b][1,5]benzothiazepine-1,3-dione |
|---|---|
| PubChem CID | 18884657 |
| Molecular Formula | C26H22N2O3S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-(4-ethylphenyl)-4-(4-methoxyphenyl)-4,5-dihydropyrrolo[3,4-b][1,5]benzothiazepine-1,3-dione |
| SMILES | CCc1ccc(N2C(=O)C3=C(C2=O)C(c2ccc(OC)cc2)Nc2ccccc2S3)cc1 |
| InChI | InChI=1S/C26H22N2O3S/c1-3-16-8-12-18(13-9-16)28-25(29)22-23(17-10-14-19(31-2)15-11-17)27-20-6-4-5-7-21(20)32-24(22)26(28)30/h4-15,23,27H,3H2,1-2H3 |
| InChIKey | AOJQUHMGWASZER-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|