C24H30ClN3O2 — CID 18885118
4-[1-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]ethyl]morpholine (PubChem CID 18885118) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is 4-[1-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]ethyl]morpholine.
| Compound Name | 4-[1-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 18885118 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 4-[1-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]ethyl]morpholine |
| SMILES | Cc1cc(OCCCCn2c(C(C)N3CCOCC3)nc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C24H30ClN3O2/c1-18-17-20(9-10-21(18)25)30-14-6-5-11-28-23-8-4-3-7-22(23)26-24(28)19(2)27-12-15-29-16-13-27/h3-4,7-10,17,19H,5-6,11-16H2,1-2H3 |
| InChIKey | FTRZFWMKRRQXFH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|