C19H15Cl4NO4 — CID 18889748
4',7'-dichloro-1'-[3-(2,4-dichlorophenoxy)propyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 18889748) has the molecular formula C19H15Cl4NO4 and a molecular weight of 463.14 g/mol. Its IUPAC name is 4',7'-dichloro-1'-[3-(2,4-dichlorophenoxy)propyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one.
| Compound Name | 4',7'-dichloro-1'-[3-(2,4-dichlorophenoxy)propyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 18889748 |
| Molecular Formula | C19H15Cl4NO4 |
| Molecular Weight | 463.14 g/mol |
| Exact Mass | 460.98 |
| IUPAC Name | 4',7'-dichloro-1'-[3-(2,4-dichlorophenoxy)propyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | O=C1N(CCCOc2ccc(Cl)cc2Cl)c2c(Cl)ccc(Cl)c2C12OCCO2 |
| InChI | InChI=1S/C19H15Cl4NO4/c20-11-2-5-15(14(23)10-11)26-7-1-6-24-17-13(22)4-3-12(21)16(17)19(18(24)25)27-8-9-28-19/h2-5,10H,1,6-9H2 |
| InChIKey | YKGOFORGPICPHC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.14 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|