C21H30N2O4S — CID 18890456
5-(azepan-1-yl)-2-butyl-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole (PubChem CID 18890456) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is 5-(azepan-1-yl)-2-butyl-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole.
| Compound Name | 5-(azepan-1-yl)-2-butyl-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole |
|---|---|
| PubChem CID | 18890456 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 5-(azepan-1-yl)-2-butyl-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole |
| SMILES | CCCCc1nc(S(=O)(=O)c2ccc(OCC)cc2)c(N2CCCCCC2)o1 |
| InChI | InChI=1S/C21H30N2O4S/c1-3-5-10-19-22-20(21(27-19)23-15-8-6-7-9-16-23)28(24,25)18-13-11-17(12-14-18)26-4-2/h11-14H,3-10,15-16H2,1-2H3 |
| InChIKey | AHTZPEUXLCBKMZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |