About 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole
5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole (PubChem CID 18890546) has the molecular formula C23H24Cl2N2O4S
and a molecular weight of 495.43 g/mol. Its IUPAC name is 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole.
Molecular Properties
| Compound Name | 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole |
| PubChem CID | 18890546 |
| Molecular Formula | C23H24Cl2N2O4S |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole |
| SMILES | CCOc1ccc(S(=O)(=O)c2nc(-c3ccc(Cl)cc3Cl)oc2N2CCCCCC2)cc1 |
| InChI | InChI=1S/C23H24Cl2N2O4S/c1-2-30-17-8-10-18(11-9-17)32(28,29)22-23(27-13-5-3-4-6-14-27)31-21(26-22)19-12-7-16(24)15-20(19)25/h7-12,15H,2-6,13-14H2,1H3 |
| InChIKey | IOTZPIYOFVJCAG-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole?
The IUPAC name of 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole (CID 18890546) is 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole.
What is the SMILES notation for 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole?
The canonical SMILES for 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole is CCOc1ccc(S(=O)(=O)c2nc(-c3ccc(Cl)cc3Cl)oc2N2CCCCCC2)cc1.
What is the InChIKey of 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole?
The InChIKey is IOTZPIYOFVJCAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24Cl2N2O4S/c1-2-30-17-8-10-18(11-9-17)32(28,29)22-23(27-13-5-3-4-6-14-27)31-21(26-22)19-12-7-16(24)15-20(19)25/h7-12,15H,2-6,13-14H2,1H3.
What are the key properties of 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole?
5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole has a molecular weight of 495.43 g/mol, XLogP of 6.26, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(azepan-1-yl)-2-(2,4-dichlorophenyl)-4-(4-ethoxyphenyl)sulfonyl-1,3-oxazole is sourced from PubChem (CID 18890546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).