C16H16F2N2O4S — CID 18893237
2-fluoro-N-[2-fluoro-4-(3-hydroxypropylsulfamoyl)phenyl]benzamide (PubChem CID 18893237) has the molecular formula C16H16F2N2O4S and a molecular weight of 370.38 g/mol. Its IUPAC name is 2-fluoro-N-[2-fluoro-4-(3-hydroxypropylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-fluoro-N-[2-fluoro-4-(3-hydroxypropylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 18893237 |
| Molecular Formula | C16H16F2N2O4S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-fluoro-N-[2-fluoro-4-(3-hydroxypropylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCCCO)cc1F)c1ccccc1F |
| InChI | InChI=1S/C16H16F2N2O4S/c17-13-5-2-1-4-12(13)16(22)20-15-7-6-11(10-14(15)18)25(23,24)19-8-3-9-21/h1-2,4-7,10,19,21H,3,8-9H2,(H,20,22) |
| InChIKey | OYZCKHFPSBIRRR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|