C23H22F2N2O3S — CID 18893361
N-[4-[(2,6-diethylphenyl)sulfamoyl]-2-fluorophenyl]-2-fluorobenzamide (PubChem CID 18893361) has the molecular formula C23H22F2N2O3S and a molecular weight of 444.50 g/mol. Its IUPAC name is N-[4-[(2,6-diethylphenyl)sulfamoyl]-2-fluorophenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[(2,6-diethylphenyl)sulfamoyl]-2-fluorophenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 18893361 |
| Molecular Formula | C23H22F2N2O3S |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[4-[(2,6-diethylphenyl)sulfamoyl]-2-fluorophenyl]-2-fluorobenzamide |
| SMILES | CCc1cccc(CC)c1NS(=O)(=O)c1ccc(NC(=O)c2ccccc2F)c(F)c1 |
| InChI | InChI=1S/C23H22F2N2O3S/c1-3-15-8-7-9-16(4-2)22(15)27-31(29,30)17-12-13-21(20(25)14-17)26-23(28)18-10-5-6-11-19(18)24/h5-14,27H,3-4H2,1-2H3,(H,26,28) |
| InChIKey | OWFMRKLBFQPCLG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |