C19H25FN2O4S2 — CID 75435489
N-(2,6-diethylphenyl)-3-fluoro-4-(propylsulfonylamino)benzenesulfonamide (PubChem CID 75435489) has the molecular formula C19H25FN2O4S2 and a molecular weight of 428.55 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-3-fluoro-4-(propylsulfonylamino)benzenesulfonamide.
| Compound Name | N-(2,6-diethylphenyl)-3-fluoro-4-(propylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 75435489 |
| Molecular Formula | C19H25FN2O4S2 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-(2,6-diethylphenyl)-3-fluoro-4-(propylsulfonylamino)benzenesulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(S(=O)(=O)Nc2c(CC)cccc2CC)cc1F |
| InChI | InChI=1S/C19H25FN2O4S2/c1-4-12-27(23,24)21-18-11-10-16(13-17(18)20)28(25,26)22-19-14(5-2)8-7-9-15(19)6-3/h7-11,13,21-22H,4-6,12H2,1-3H3 |
| InChIKey | XMUHORJHOXGAEN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |