C27H29N3O4S — CID 18907530
3,3-dimethyl-N-[3-[2-(2-methyl-4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide (PubChem CID 18907530) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 3,3-dimethyl-N-[3-[2-(2-methyl-4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[3-[2-(2-methyl-4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide |
|---|---|
| PubChem CID | 18907530 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 3,3-dimethyl-N-[3-[2-(2-methyl-4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C(Sc1cccc(NC(=O)CC(C)(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O4S/c1-18-15-21(30(33)34)13-14-23(18)29-26(32)25(19-9-6-5-7-10-19)35-22-12-8-11-20(16-22)28-24(31)17-27(2,3)4/h5-16,25H,17H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | RYUGKGRXHCAWNU-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|