C15H18ClNO4 — CID 18914181
4-(1-acetylpiperidin-4-yl)oxy-2-methoxybenzoyl chloride (PubChem CID 18914181) has the molecular formula C15H18ClNO4 and a molecular weight of 311.77 g/mol. Its IUPAC name is 4-(1-acetylpiperidin-4-yl)oxy-2-methoxybenzoyl chloride.
| Compound Name | 4-(1-acetylpiperidin-4-yl)oxy-2-methoxybenzoyl chloride |
|---|---|
| PubChem CID | 18914181 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-(1-acetylpiperidin-4-yl)oxy-2-methoxybenzoyl chloride |
| SMILES | COc1cc(OC2CCN(C(C)=O)CC2)ccc1C(=O)Cl |
| InChI | InChI=1S/C15H18ClNO4/c1-10(18)17-7-5-11(6-8-17)21-12-3-4-13(15(16)19)14(9-12)20-2/h3-4,9,11H,5-8H2,1-2H3 |
| InChIKey | RTNYYMZBIKYUCM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|