C37H48N6O9 — CID 54050193
tert-butyl 4-[4-[1,3-didiazo-3-[2-methoxy-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]-2-oxopropyl]-3-methoxyphenoxy]piperidine-1-carboxylate (PubChem CID 54050193) has the molecular formula C37H48N6O9 and a molecular weight of 720.82 g/mol. Its IUPAC name is tert-butyl 4-[4-[1,3-didiazo-3-[2-methoxy-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]-2-oxopropyl]-3-methoxyphenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[1,3-didiazo-3-[2-methoxy-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]-2-oxopropyl]-3-methoxyphenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54050193 |
| Molecular Formula | C37H48N6O9 |
| Molecular Weight | 720.82 g/mol |
| Exact Mass | 720.35 |
| IUPAC Name | tert-butyl 4-[4-[1,3-didiazo-3-[2-methoxy-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]-2-oxopropyl]-3-methoxyphenoxy]piperidine-1-carboxylate |
| SMILES | COc1cc(OC2CCN(C(=O)OC(C)(C)C)CC2)ccc1C(=[N+]=[N-])C(=O)C(=[N+]=[N-])c1ccc(OC2CCN(C(=O)OC(C)(C)C)CC2)cc1OC |
| InChI | InChI=1S/C37H48N6O9/c1-36(2,3)51-34(45)42-17-13-23(14-18-42)49-25-9-11-27(29(21-25)47-7)31(40-38)33(44)32(41-39)28-12-10-26(22-30(28)48-8)50-24-15-19-43(20-16-24)35(46)52-37(4,5)6/h9-12,21-24H,13-20H2,1-8H3 |
| InChIKey | LSIQEMKEMXOTDI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 185.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.82 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|