About 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one
6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one (PubChem CID 18917134) has the molecular formula C16H16N2O3
and a molecular weight of 284.31 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one |
| PubChem CID | 18917134 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one |
| SMILES | CCC#CCN1N=C(c2ccc3c(c2)OCO3)CCC1=O |
| InChI | InChI=1S/C16H16N2O3/c1-2-3-4-9-18-16(19)8-6-13(17-18)12-5-7-14-15(10-12)21-11-20-14/h5,7,10H,2,6,8-9,11H2,1H3 |
| InChIKey | XBRWYSRWAAZNDN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one?
The IUPAC name of 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one (CID 18917134) is 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one?
The canonical SMILES for 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one is CCC#CCN1N=C(c2ccc3c(c2)OCO3)CCC1=O.
What is the InChIKey of 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one?
The InChIKey is XBRWYSRWAAZNDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-2-3-4-9-18-16(19)8-6-13(17-18)12-5-7-14-15(10-12)21-11-20-14/h5,7,10H,2,6,8-9,11H2,1H3.
What are the key properties of 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one?
6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one has a molecular weight of 284.31 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 18917134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).