C16H16N2O3 — CID 18917134
6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one (PubChem CID 18917134) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 18917134 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-2-pent-2-ynyl-4,5-dihydropyridazin-3-one |
| SMILES | CCC#CCN1N=C(c2ccc3c(c2)OCO3)CCC1=O |
| InChI | InChI=1S/C16H16N2O3/c1-2-3-4-9-18-16(19)8-6-13(17-18)12-5-7-14-15(10-12)21-11-20-14/h5,7,10H,2,6,8-9,11H2,1H3 |
| InChIKey | XBRWYSRWAAZNDN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|