C18H27ClN2O3 — CID 18921836
1-[6-[(3,5-dimethoxyphenyl)methoxy]hexyl]imidazole;hydrochloride (PubChem CID 18921836) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is 1-[6-[(3,5-dimethoxyphenyl)methoxy]hexyl]imidazole;hydrochloride.
| Compound Name | 1-[6-[(3,5-dimethoxyphenyl)methoxy]hexyl]imidazole;hydrochloride |
|---|---|
| PubChem CID | 18921836 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[6-[(3,5-dimethoxyphenyl)methoxy]hexyl]imidazole;hydrochloride |
| SMILES | COc1cc(COCCCCCCn2ccnc2)cc(OC)c1.Cl |
| InChI | InChI=1S/C18H26N2O3.ClH/c1-21-17-11-16(12-18(13-17)22-2)14-23-10-6-4-3-5-8-20-9-7-19-15-20;/h7,9,11-13,15H,3-6,8,10,14H2,1-2H3;1H |
| InChIKey | WCGHMZVBIQPAAM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|