C21H23NO2 — CID 18921964
6-benzhydryl-1-azabicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 18921964) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 6-benzhydryl-1-azabicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | 6-benzhydryl-1-azabicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 18921964 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 6-benzhydryl-1-azabicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | O=C(O)C1CC2CCN1C(C(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C21H23NO2/c23-21(24)19-14-15-11-12-22(19)18(13-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,15,18-20H,11-14H2,(H,23,24) |
| InChIKey | GJIYLQLACQCNOO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |