C12H14INO2 — CID 69182607
1-[iodo(phenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 69182607) has the molecular formula C12H14INO2 and a molecular weight of 331.15 g/mol. Its IUPAC name is 1-[iodo(phenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[iodo(phenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 69182607 |
| Molecular Formula | C12H14INO2 |
| Molecular Weight | 331.15 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 1-[iodo(phenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(I)c1ccccc1 |
| InChI | InChI=1S/C12H14INO2/c13-11(9-5-2-1-3-6-9)14-8-4-7-10(14)12(15)16/h1-3,5-6,10-11H,4,7-8H2,(H,15,16) |
| InChIKey | ZXTVUQZWNGJIQD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|