C15H17NO4 — CID 90960335
(2S)-1-(1-carboxy-3-phenylprop-2-enyl)pyrrolidine-2-carboxylic acid (PubChem CID 90960335) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is (2S)-1-(1-carboxy-3-phenylprop-2-enyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(1-carboxy-3-phenylprop-2-enyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 90960335 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (2S)-1-(1-carboxy-3-phenylprop-2-enyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C(C=Cc1ccccc1)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C15H17NO4/c17-14(18)12-7-4-10-16(12)13(15(19)20)9-8-11-5-2-1-3-6-11/h1-3,5-6,8-9,12-13H,4,7,10H2,(H,17,18)(H,19,20)/t12-,13?/m0/s1 |
| InChIKey | ZPIWMTUWUKJGIU-UEWDXFNNSA-N |
| XLogP | 1.70 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |