C13H16ClNO4 — CID 71614177
(2S)-1-[(S)-carboxy(phenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 71614177) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is (2S)-1-[(S)-carboxy(phenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | (2S)-1-[(S)-carboxy(phenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 71614177 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (2S)-1-[(S)-carboxy(phenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@H](c1ccccc1)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C13H15NO4.ClH/c15-12(16)10-7-4-8-14(10)11(13(17)18)9-5-2-1-3-6-9;/h1-3,5-6,10-11H,4,7-8H2,(H,15,16)(H,17,18);1H/t10-,11-;/m0./s1 |
| InChIKey | KCJMYJXZZZGWBY-ACMTZBLWSA-N |
| XLogP | 1.78 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |