C26H31F6N3O3 — CID 18925700
2-tert-butyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide;methyl 2-tert-butyl-5-(trifluoromethyl)benzoate (PubChem CID 18925700) has the molecular formula C26H31F6N3O3 and a molecular weight of 547.54 g/mol. Its IUPAC name is 2-tert-butyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide;methyl 2-tert-butyl-5-(trifluoromethyl)benzoate.
| Compound Name | 2-tert-butyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide;methyl 2-tert-butyl-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 18925700 |
| Molecular Formula | C26H31F6N3O3 |
| Molecular Weight | 547.54 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 2-tert-butyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide;methyl 2-tert-butyl-5-(trifluoromethyl)benzoate |
| SMILES | CC(C)(C)c1ccc(C(F)(F)F)cc1C(=O)N=C(N)N.COC(=O)c1cc(C(F)(F)F)ccc1C(C)(C)C |
| InChI | InChI=1S/C13H16F3N3O.C13H15F3O2/c1-12(2,3)9-5-4-7(13(14,15)16)6-8(9)10(20)19-11(17)18;1-12(2,3)10-6-5-8(13(14,15)16)7-9(10)11(17)18-4/h4-6H,1-3H3,(H4,17,18,19,20);5-7H,1-4H3 |
| InChIKey | LZGGZGZPLSPNBB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|