C22H22F3NO5S — CID 18926329
N-methyl-3-(3-methylthiophen-2-yl)-3-[3-(trifluoromethyl)naphthalen-1-yl]oxypropan-1-amine;oxalic acid (PubChem CID 18926329) has the molecular formula C22H22F3NO5S and a molecular weight of 469.48 g/mol. Its IUPAC name is N-methyl-3-(3-methylthiophen-2-yl)-3-[3-(trifluoromethyl)naphthalen-1-yl]oxypropan-1-amine;oxalic acid.
| Compound Name | N-methyl-3-(3-methylthiophen-2-yl)-3-[3-(trifluoromethyl)naphthalen-1-yl]oxypropan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 18926329 |
| Molecular Formula | C22H22F3NO5S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | N-methyl-3-(3-methylthiophen-2-yl)-3-[3-(trifluoromethyl)naphthalen-1-yl]oxypropan-1-amine;oxalic acid |
| SMILES | CNCCC(Oc1cc(C(F)(F)F)cc2ccccc12)c1sccc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H20F3NOS.C2H2O4/c1-13-8-10-26-19(13)17(7-9-24-2)25-18-12-15(20(21,22)23)11-14-5-3-4-6-16(14)18;3-1(4)2(5)6/h3-6,8,10-12,17,24H,7,9H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | WVFZGJNNWXESPI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|