C16H34O4 — CID 18927938
2,4-bis(tert-butylperoxy)-2,4-dimethylhexane (PubChem CID 18927938) has the molecular formula C16H34O4 and a molecular weight of 290.44 g/mol. Its IUPAC name is 2,4-bis(tert-butylperoxy)-2,4-dimethylhexane.
| Compound Name | 2,4-bis(tert-butylperoxy)-2,4-dimethylhexane |
|---|---|
| PubChem CID | 18927938 |
| Molecular Formula | C16H34O4 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 2,4-bis(tert-butylperoxy)-2,4-dimethylhexane |
| SMILES | CCC(C)(CC(C)(C)OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C16H34O4/c1-11-16(10,20-18-14(5,6)7)12-15(8,9)19-17-13(2,3)4/h11-12H2,1-10H3 |
| InChIKey | HESNPRBMFPPTBB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|