C18H29N3O7 — CID 18929143
2-methyl-2-[2-[[2-methyl-4-[(5-nitrofuran-2-yl)methoxy]-3-oxobutan-2-yl]amino]oxyethylamino]pentan-3-one (PubChem CID 18929143) has the molecular formula C18H29N3O7 and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-methyl-2-[2-[[2-methyl-4-[(5-nitrofuran-2-yl)methoxy]-3-oxobutan-2-yl]amino]oxyethylamino]pentan-3-one.
| Compound Name | 2-methyl-2-[2-[[2-methyl-4-[(5-nitrofuran-2-yl)methoxy]-3-oxobutan-2-yl]amino]oxyethylamino]pentan-3-one |
|---|---|
| PubChem CID | 18929143 |
| Molecular Formula | C18H29N3O7 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-methyl-2-[2-[[2-methyl-4-[(5-nitrofuran-2-yl)methoxy]-3-oxobutan-2-yl]amino]oxyethylamino]pentan-3-one |
| SMILES | CCC(=O)C(C)(C)NCCONC(C)(C)C(=O)COCc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H29N3O7/c1-6-14(22)17(2,3)19-9-10-27-20-18(4,5)15(23)12-26-11-13-7-8-16(28-13)21(24)25/h7-8,19-20H,6,9-12H2,1-5H3 |
| InChIKey | BCVNFHAUWNIFLU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|